C15H16N4O3S2 — CID 122276037
4-methoxy-3-methyl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide (PubChem CID 122276037) has the molecular formula C15H16N4O3S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-methoxy-3-methyl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-3-methyl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122276037 |
| Molecular Formula | C15H16N4O3S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 4-methoxy-3-methyl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2cn(-c3ccsc3)nn2)cc1C |
| InChI | InChI=1S/C15H16N4O3S2/c1-11-7-14(3-4-15(11)22-2)24(20,21)16-8-12-9-19(18-17-12)13-5-6-23-10-13/h3-7,9-10,16H,8H2,1-2H3 |
| InChIKey | YRTJGAQDHHKAQU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |