C24H23N5O6S — CID 165437335
N-[[3-methoxy-4-[[1-(4-nitrophenyl)triazol-4-yl]methoxy]phenyl]methyl]-4-methylbenzenesulfonamide (PubChem CID 165437335) has the molecular formula C24H23N5O6S and a molecular weight of 509.54 g/mol. Its IUPAC name is N-[[3-methoxy-4-[[1-(4-nitrophenyl)triazol-4-yl]methoxy]phenyl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[3-methoxy-4-[[1-(4-nitrophenyl)triazol-4-yl]methoxy]phenyl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 165437335 |
| Molecular Formula | C24H23N5O6S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-[[3-methoxy-4-[[1-(4-nitrophenyl)triazol-4-yl]methoxy]phenyl]methyl]-4-methylbenzenesulfonamide |
| SMILES | COc1cc(CNS(=O)(=O)c2ccc(C)cc2)ccc1OCc1cn(-c2ccc([N+](=O)[O-])cc2)nn1 |
| InChI | InChI=1S/C24H23N5O6S/c1-17-3-10-22(11-4-17)36(32,33)25-14-18-5-12-23(24(13-18)34-2)35-16-19-15-28(27-26-19)20-6-8-21(9-7-20)29(30)31/h3-13,15,25H,14,16H2,1-2H3 |
| InChIKey | LWQBGDAXKKUCGH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 138.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|