C27H33N5O5 — CID 155807368
(E)-N-[[3-methoxy-4-[[1-(3-nitrophenyl)triazol-4-yl]methoxy]phenyl]methyl]-8-methylnon-6-enamide (PubChem CID 155807368) has the molecular formula C27H33N5O5 and a molecular weight of 507.59 g/mol. Its IUPAC name is (E)-N-[[3-methoxy-4-[[1-(3-nitrophenyl)triazol-4-yl]methoxy]phenyl]methyl]-8-methylnon-6-enamide.
| Compound Name | (E)-N-[[3-methoxy-4-[[1-(3-nitrophenyl)triazol-4-yl]methoxy]phenyl]methyl]-8-methylnon-6-enamide |
|---|---|
| PubChem CID | 155807368 |
| Molecular Formula | C27H33N5O5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | (E)-N-[[3-methoxy-4-[[1-(3-nitrophenyl)triazol-4-yl]methoxy]phenyl]methyl]-8-methylnon-6-enamide |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OCc1cn(-c2cccc([N+](=O)[O-])c2)nn1 |
| InChI | InChI=1S/C27H33N5O5/c1-20(2)9-6-4-5-7-12-27(33)28-17-21-13-14-25(26(15-21)36-3)37-19-22-18-31(30-29-22)23-10-8-11-24(16-23)32(34)35/h6,8-11,13-16,18,20H,4-5,7,12,17,19H2,1-3H3,(H,28,33)/b9-6+ |
| InChIKey | OWZUIJUUCLOFNX-RMKNXTFCSA-N |
| XLogP | 5.15 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|