C25H33NO7S — CID 130381022
[4-[[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]methyl]phenyl] hydrogen sulfate (PubChem CID 130381022) has the molecular formula C25H33NO7S and a molecular weight of 491.61 g/mol. Its IUPAC name is [4-[[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]methyl]phenyl] hydrogen sulfate.
| Compound Name | [4-[[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]methyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 130381022 |
| Molecular Formula | C25H33NO7S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | [4-[[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]methyl]phenyl] hydrogen sulfate |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OCc1ccc(OS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C25H33NO7S/c1-19(2)8-6-4-5-7-9-25(27)26-17-21-12-15-23(24(16-21)31-3)32-18-20-10-13-22(14-11-20)33-34(28,29)30/h6,8,10-16,19H,4-5,7,9,17-18H2,1-3H3,(H,26,27)(H,28,29,30)/b8-6+ |
| InChIKey | QYRKNHVLXZZPEH-SOFGYWHQSA-N |
| XLogP | 4.84 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|