C19H27NO4 — CID 141159434
2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]benzoic acid (PubChem CID 141159434) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]benzoic acid.
| Compound Name | 2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 141159434 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]benzoic acid |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C19H27NO4/c1-14(2)8-6-4-5-7-9-18(21)20-13-15-10-11-16(19(22)23)17(12-15)24-3/h6,8,10-12,14H,4-5,7,9,13H2,1-3H3,(H,20,21)(H,22,23)/b8-6+ |
| InChIKey | GJJRDOJBSLSISY-SOFGYWHQSA-N |
| XLogP | 3.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|