C25H40N2O4 — CID 175117743
2-(diethylamino)-2-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl]propanoic acid (PubChem CID 175117743) has the molecular formula C25H40N2O4 and a molecular weight of 432.61 g/mol. Its IUPAC name is 2-(diethylamino)-2-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl]propanoic acid.
| Compound Name | 2-(diethylamino)-2-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 175117743 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 2-(diethylamino)-2-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl]propanoic acid |
| SMILES | CCN(CC)C(C)(C(=O)O)c1ccc(CNC(=O)CCCC/C=C/C(C)C)cc1OC |
| InChI | InChI=1S/C25H40N2O4/c1-7-27(8-2)25(5,24(29)30)21-16-15-20(17-22(21)31-6)18-26-23(28)14-12-10-9-11-13-19(3)4/h11,13,15-17,19H,7-10,12,14,18H2,1-6H3,(H,26,28)(H,29,30)/b13-11+ |
| InChIKey | CXVHTBRPLIWBMP-ACCUITESSA-N |
| XLogP | 4.73 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|