C28H46N2O4 — CID 164518129
(2R)-2-(diethylamino)-2-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl]-4-methylpentanoic acid (PubChem CID 164518129) has the molecular formula C28H46N2O4 and a molecular weight of 474.69 g/mol. Its IUPAC name is (2R)-2-(diethylamino)-2-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl]-4-methylpentanoic acid.
| Compound Name | (2R)-2-(diethylamino)-2-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 164518129 |
| Molecular Formula | C28H46N2O4 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | (2R)-2-(diethylamino)-2-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl]-4-methylpentanoic acid |
| SMILES | CCN(CC)[C@@](CC(C)C)(C(=O)O)c1ccc(CNC(=O)CCCC/C=C/C(C)C)cc1OC |
| InChI | InChI=1S/C28H46N2O4/c1-8-30(9-2)28(27(32)33,19-22(5)6)24-17-16-23(18-25(24)34-7)20-29-26(31)15-13-11-10-12-14-21(3)4/h12,14,16-18,21-22H,8-11,13,15,19-20H2,1-7H3,(H,29,31)(H,32,33)/b14-12+/t28-/m1/s1 |
| InChIKey | LZEMNFVSVMXLFZ-WOWPOYAISA-N |
| XLogP | 5.75 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|