C17H25NO4 — CID 162817846
8-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]non-6-enamide (PubChem CID 162817846) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 8-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]non-6-enamide.
| Compound Name | 8-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]non-6-enamide |
|---|---|
| PubChem CID | 162817846 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 8-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]non-6-enamide |
| SMILES | COc1cc(CNC(=O)CCCCC=CC(C)O)ccc1O |
| InChI | InChI=1S/C17H25NO4/c1-13(19)7-5-3-4-6-8-17(21)18-12-14-9-10-15(20)16(11-14)22-2/h5,7,9-11,13,19-20H,3-4,6,8,12H2,1-2H3,(H,18,21) |
| InChIKey | HXWCCFFONCLBHK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|