C17H26NO5- — CID 20976476
N-[(4-hydroxy-3-methoxyphenyl)methyl]heptanamide acetate (PubChem CID 20976476) has the molecular formula C17H26NO5- and a molecular weight of 324.40 g/mol. Its IUPAC name is N-[(4-hydroxy-3-methoxyphenyl)methyl]heptanamide acetate.
| Compound Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]heptanamide acetate |
|---|---|
| PubChem CID | 20976476 |
| Molecular Formula | C17H26NO5- |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]heptanamide acetate |
| SMILES | CC(=O)[O-].CCCCCCC(=O)NCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C15H23NO3.C2H4O2/c1-3-4-5-6-7-15(18)16-11-12-8-9-13(17)14(10-12)19-2;1-2(3)4/h8-10,17H,3-7,11H2,1-2H3,(H,16,18);1H3,(H,3,4)/p-1 |
| InChIKey | MCFQAYZILACQHT-UHFFFAOYSA-M |
| XLogP | 1.74 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|