C25H36N2O6 — CID 68817622
N-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide;methyl 3-amino-4-hydroxybenzoate (PubChem CID 68817622) has the molecular formula C25H36N2O6 and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide;methyl 3-amino-4-hydroxybenzoate.
| Compound Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide;methyl 3-amino-4-hydroxybenzoate |
|---|---|
| PubChem CID | 68817622 |
| Molecular Formula | C25H36N2O6 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide;methyl 3-amino-4-hydroxybenzoate |
| SMILES | CCCCCCCCC(=O)NCc1ccc(O)c(OC)c1.COC(=O)c1ccc(O)c(N)c1 |
| InChI | InChI=1S/C17H27NO3.C8H9NO3/c1-3-4-5-6-7-8-9-17(20)18-13-14-10-11-15(19)16(12-14)21-2;1-12-8(11)5-2-3-7(10)6(9)4-5/h10-12,19H,3-9,13H2,1-2H3,(H,18,20);2-4,10H,9H2,1H3 |
| InChIKey | IMSNRJJLVTUXTC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|