C26H46N4O3 — CID 171348881
N-[[4-[8-(diaminomethylideneamino)octoxy]-3-methoxyphenyl]methyl]nonanamide (PubChem CID 171348881) has the molecular formula C26H46N4O3 and a molecular weight of 462.68 g/mol. Its IUPAC name is N-[[4-[8-(diaminomethylideneamino)octoxy]-3-methoxyphenyl]methyl]nonanamide.
| Compound Name | N-[[4-[8-(diaminomethylideneamino)octoxy]-3-methoxyphenyl]methyl]nonanamide |
|---|---|
| PubChem CID | 171348881 |
| Molecular Formula | C26H46N4O3 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.36 |
| IUPAC Name | N-[[4-[8-(diaminomethylideneamino)octoxy]-3-methoxyphenyl]methyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCc1ccc(OCCCCCCCCN=C(N)N)c(OC)c1 |
| InChI | InChI=1S/C26H46N4O3/c1-3-4-5-6-9-12-15-25(31)30-21-22-16-17-23(24(20-22)32-2)33-19-14-11-8-7-10-13-18-29-26(27)28/h16-17,20H,3-15,18-19,21H2,1-2H3,(H,30,31)(H4,27,28,29) |
| InChIKey | DVRSJDVXVNMXHN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|