C24H40N2O3 — CID 67825156
(Z)-N-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]tetradec-9-enamide (PubChem CID 67825156) has the molecular formula C24H40N2O3 and a molecular weight of 404.60 g/mol. Its IUPAC name is (Z)-N-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]tetradec-9-enamide.
| Compound Name | (Z)-N-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]tetradec-9-enamide |
|---|---|
| PubChem CID | 67825156 |
| Molecular Formula | C24H40N2O3 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | (Z)-N-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]tetradec-9-enamide |
| SMILES | CCCC/C=C\CCCCCCCC(=O)NCc1ccc(OCCN)c(OC)c1 |
| InChI | InChI=1S/C24H40N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-24(27)26-20-21-15-16-22(29-18-17-25)23(19-21)28-2/h6-7,15-16,19H,3-5,8-14,17-18,20,25H2,1-2H3,(H,26,27)/b7-6- |
| InChIKey | ISLQANODKDOPAY-SREVYHEPSA-N |
| XLogP | 5.13 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|