C29H51N3O3 — CID 54205535
1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-octadec-9-enylurea (PubChem CID 54205535) has the molecular formula C29H51N3O3 and a molecular weight of 489.75 g/mol. Its IUPAC name is 1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-octadec-9-enylurea.
| Compound Name | 1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-octadec-9-enylurea |
|---|---|
| PubChem CID | 54205535 |
| Molecular Formula | C29H51N3O3 |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 489.39 |
| IUPAC Name | 1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-octadec-9-enylurea |
| SMILES | CCCCCCCCC=CCCCCCCCCNC(=O)NCc1ccc(OCCN)c(OC)c1 |
| InChI | InChI=1S/C29H51N3O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-31-29(33)32-25-26-19-20-27(35-23-21-30)28(24-26)34-2/h10-11,19-20,24H,3-9,12-18,21-23,25,30H2,1-2H3,(H2,31,32,33) |
| InChIKey | PSFKSMVSTCVTEI-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|