C28H46N4O3 — CID 54514212
N-[[4-(2-azidoethoxy)-3-methoxyphenyl]methyl]octadec-9-enamide (PubChem CID 54514212) has the molecular formula C28H46N4O3 and a molecular weight of 486.70 g/mol. Its IUPAC name is N-[[4-(2-azidoethoxy)-3-methoxyphenyl]methyl]octadec-9-enamide.
| Compound Name | N-[[4-(2-azidoethoxy)-3-methoxyphenyl]methyl]octadec-9-enamide |
|---|---|
| PubChem CID | 54514212 |
| Molecular Formula | C28H46N4O3 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | N-[[4-(2-azidoethoxy)-3-methoxyphenyl]methyl]octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCc1ccc(OCCN=[N+]=[N-])c(OC)c1 |
| InChI | InChI=1S/C28H46N4O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-28(33)30-24-25-19-20-26(27(23-25)34-2)35-22-21-31-32-29/h10-11,19-20,23H,3-9,12-18,21-22,24H2,1-2H3,(H,30,33) |
| InChIKey | YLGPSVYJYCOZIV-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|