C30H50N2O3 — CID 67783345
(Z)-N-[[4-[amino(cyclopropyl)methoxy]-3-methoxyphenyl]methyl]octadec-9-enamide (PubChem CID 67783345) has the molecular formula C30H50N2O3 and a molecular weight of 486.74 g/mol. Its IUPAC name is (Z)-N-[[4-[amino(cyclopropyl)methoxy]-3-methoxyphenyl]methyl]octadec-9-enamide.
| Compound Name | (Z)-N-[[4-[amino(cyclopropyl)methoxy]-3-methoxyphenyl]methyl]octadec-9-enamide |
|---|---|
| PubChem CID | 67783345 |
| Molecular Formula | C30H50N2O3 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.38 |
| IUPAC Name | (Z)-N-[[4-[amino(cyclopropyl)methoxy]-3-methoxyphenyl]methyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCc1ccc(OC(N)C2CC2)c(OC)c1 |
| InChI | InChI=1S/C30H50N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-29(33)32-24-25-19-22-27(28(23-25)34-2)35-30(31)26-20-21-26/h10-11,19,22-23,26,30H,3-9,12-18,20-21,24,31H2,1-2H3,(H,32,33)/b11-10- |
| InChIKey | BSXQPRRPOYBLNK-KHPPLWFESA-N |
| XLogP | 7.42 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|