C20H32NO7P — CID 130380983
1-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]ethyl dihydrogen phosphate (PubChem CID 130380983) has the molecular formula C20H32NO7P and a molecular weight of 429.45 g/mol. Its IUPAC name is 1-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]ethyl dihydrogen phosphate.
| Compound Name | 1-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 130380983 |
| Molecular Formula | C20H32NO7P |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]ethyl dihydrogen phosphate |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OC(C)OP(=O)(O)O |
| InChI | InChI=1S/C20H32NO7P/c1-15(2)9-7-5-6-8-10-20(22)21-14-17-11-12-18(19(13-17)26-4)27-16(3)28-29(23,24)25/h7,9,11-13,15-16H,5-6,8,10,14H2,1-4H3,(H,21,22)(H2,23,24,25)/b9-7+ |
| InChIKey | AJARTOYWMJFGEF-VQHVLOKHSA-N |
| XLogP | 3.92 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|