C20H28N2O7 — CID 141228828
[2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 2-nitrooxyacetate (PubChem CID 141228828) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 2-nitrooxyacetate.
| Compound Name | [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 2-nitrooxyacetate |
|---|---|
| PubChem CID | 141228828 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 2-nitrooxyacetate |
| SMILES | COc1cc(CNC(=O)CCCCC=CC(C)C)ccc1OC(=O)CO[N+](=O)[O-] |
| InChI | InChI=1S/C20H28N2O7/c1-15(2)8-6-4-5-7-9-19(23)21-13-16-10-11-17(18(12-16)27-3)29-20(24)14-28-22(25)26/h6,8,10-12,15H,4-5,7,9,13-14H2,1-3H3,(H,21,23) |
| InChIKey | KQNWXCPQCLQMQE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|