C27H40FNO4 — CID 143320648
[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 2-[1-(fluoromethyl)cyclohexyl]acetate (PubChem CID 143320648) has the molecular formula C27H40FNO4 and a molecular weight of 461.62 g/mol. Its IUPAC name is [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 2-[1-(fluoromethyl)cyclohexyl]acetate.
| Compound Name | [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 2-[1-(fluoromethyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 143320648 |
| Molecular Formula | C27H40FNO4 |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 2-[1-(fluoromethyl)cyclohexyl]acetate |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OC(=O)CC1(CF)CCCCC1 |
| InChI | InChI=1S/C27H40FNO4/c1-21(2)11-7-4-5-8-12-25(30)29-19-22-13-14-23(24(17-22)32-3)33-26(31)18-27(20-28)15-9-6-10-16-27/h7,11,13-14,17,21H,4-6,8-10,12,15-16,18-20H2,1-3H3,(H,29,30)/b11-7+ |
| InChIKey | ZMZIYUNWYDUVAK-YRNVUSSQSA-N |
| XLogP | 6.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|