C36H52N2O6 — CID 76694614
[1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexyl] [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] carbonate (PubChem CID 76694614) has the molecular formula C36H52N2O6 and a molecular weight of 608.82 g/mol. Its IUPAC name is [1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexyl] [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] carbonate.
| Compound Name | [1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexyl] [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] carbonate |
|---|---|
| PubChem CID | 76694614 |
| Molecular Formula | C36H52N2O6 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | [1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexyl] [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] carbonate |
| SMILES | COc1ccc(C(CN(C)C)C2(OC(=O)Oc3ccc(CNC(=O)CCCCC=CC(C)C)cc3OC)CCCCC2)cc1 |
| InChI | InChI=1S/C36H52N2O6/c1-27(2)14-10-7-8-11-15-34(39)37-25-28-16-21-32(33(24-28)42-6)43-35(40)44-36(22-12-9-13-23-36)31(26-38(3)4)29-17-19-30(41-5)20-18-29/h10,14,16-21,24,27,31H,7-9,11-13,15,22-23,25-26H2,1-6H3,(H,37,39) |
| InChIKey | VXIZTGINLAUGRT-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|