C28H36N2O9 — CID 88979114
(4,5-dimethoxy-2-nitrophenyl)methyl [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] carbonate (PubChem CID 88979114) has the molecular formula C28H36N2O9 and a molecular weight of 544.60 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)methyl [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] carbonate.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)methyl [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] carbonate |
|---|---|
| PubChem CID | 88979114 |
| Molecular Formula | C28H36N2O9 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)methyl [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] carbonate |
| SMILES | COc1cc(COC(=O)Oc2ccc(CNC(=O)CCCC/C=C/C(C)C)cc2OC)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C28H36N2O9/c1-19(2)10-8-6-7-9-11-27(31)29-17-20-12-13-23(24(14-20)35-3)39-28(32)38-18-21-15-25(36-4)26(37-5)16-22(21)30(33)34/h8,10,12-16,19H,6-7,9,11,17-18H2,1-5H3,(H,29,31)/b10-8+ |
| InChIKey | PYJZQHZYGPRZFZ-CSKARUKUSA-N |
| XLogP | 5.72 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|