C26H41N2O7+ — CID 130381086
[3-[[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]carbonyloxymethoxy]-3-oxopropyl]-trimethylazanium (PubChem CID 130381086) has the molecular formula C26H41N2O7+ and a molecular weight of 493.62 g/mol. Its IUPAC name is [3-[[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]carbonyloxymethoxy]-3-oxopropyl]-trimethylazanium.
| Compound Name | [3-[[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]carbonyloxymethoxy]-3-oxopropyl]-trimethylazanium |
|---|---|
| PubChem CID | 130381086 |
| Molecular Formula | C26H41N2O7+ |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | [3-[[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]carbonyloxymethoxy]-3-oxopropyl]-trimethylazanium |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OC(=O)OCOC(=O)CC[N+](C)(C)C |
| InChI | InChI=1S/C26H40N2O7/c1-20(2)11-9-7-8-10-12-24(29)27-18-21-13-14-22(23(17-21)32-6)35-26(31)34-19-33-25(30)15-16-28(3,4)5/h9,11,13-14,17,20H,7-8,10,12,15-16,18-19H2,1-6H3/p+1/b11-9+ |
| InChIKey | ISUFDXRAYIWDOY-PKNBQFBNSA-O |
| XLogP | 4.20 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|