C25H38N2O7 — CID 130381092
1-[2-(dimethylamino)-2-oxoethoxy]ethyl [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] carbonate (PubChem CID 130381092) has the molecular formula C25H38N2O7 and a molecular weight of 478.59 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-oxoethoxy]ethyl [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] carbonate.
| Compound Name | 1-[2-(dimethylamino)-2-oxoethoxy]ethyl [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] carbonate |
|---|---|
| PubChem CID | 130381092 |
| Molecular Formula | C25H38N2O7 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 1-[2-(dimethylamino)-2-oxoethoxy]ethyl [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] carbonate |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OC(=O)OC(C)OCC(=O)N(C)C |
| InChI | InChI=1S/C25H38N2O7/c1-18(2)11-9-7-8-10-12-23(28)26-16-20-13-14-21(22(15-20)31-6)34-25(30)33-19(3)32-17-24(29)27(4)5/h9,11,13-15,18-19H,7-8,10,12,16-17H2,1-6H3,(H,26,28)/b11-9+ |
| InChIKey | ATRSWWKLUAXKGA-PKNBQFBNSA-N |
| XLogP | 4.05 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|