C19H28NO8P — CID 130380968
[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] phosphono carbonate (PubChem CID 130380968) has the molecular formula C19H28NO8P and a molecular weight of 429.41 g/mol. Its IUPAC name is [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] phosphono carbonate.
| Compound Name | [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] phosphono carbonate |
|---|---|
| PubChem CID | 130380968 |
| Molecular Formula | C19H28NO8P |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] phosphono carbonate |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OC(=O)OP(=O)(O)O |
| InChI | InChI=1S/C19H28NO8P/c1-14(2)8-6-4-5-7-9-18(21)20-13-15-10-11-16(17(12-15)26-3)27-19(22)28-29(23,24)25/h6,8,10-12,14H,4-5,7,9,13H2,1-3H3,(H,20,21)(H2,23,24,25)/b8-6+ |
| InChIKey | LFKFNPGWLYAHHT-SOFGYWHQSA-N |
| XLogP | 3.69 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|