C19H30NO6P — CID 145358657
[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]methyl dihydrogen phosphite (PubChem CID 145358657) has the molecular formula C19H30NO6P and a molecular weight of 399.42 g/mol. Its IUPAC name is [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]methyl dihydrogen phosphite.
| Compound Name | [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]methyl dihydrogen phosphite |
|---|---|
| PubChem CID | 145358657 |
| Molecular Formula | C19H30NO6P |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenoxy]methyl dihydrogen phosphite |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OCOP(O)O |
| InChI | InChI=1S/C19H30NO6P/c1-15(2)8-6-4-5-7-9-19(21)20-13-16-10-11-17(18(12-16)24-3)25-14-26-27(22)23/h6,8,10-12,15,22-23H,4-5,7,9,13-14H2,1-3H3,(H,20,21)/b8-6+ |
| InChIKey | NWAWGJCDWATOQD-SOFGYWHQSA-N |
| XLogP | 3.65 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|