C25H33NO5S — CID 145358648
(E)-N-[[4-[(4-hydroxysulfanyloxyphenyl)methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide (PubChem CID 145358648) has the molecular formula C25H33NO5S and a molecular weight of 459.61 g/mol. Its IUPAC name is (E)-N-[[4-[(4-hydroxysulfanyloxyphenyl)methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide.
| Compound Name | (E)-N-[[4-[(4-hydroxysulfanyloxyphenyl)methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide |
|---|---|
| PubChem CID | 145358648 |
| Molecular Formula | C25H33NO5S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | (E)-N-[[4-[(4-hydroxysulfanyloxyphenyl)methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OCc1ccc(OSO)cc1 |
| InChI | InChI=1S/C25H33NO5S/c1-19(2)8-6-4-5-7-9-25(27)26-17-21-12-15-23(24(16-21)29-3)30-18-20-10-13-22(14-11-20)31-32-28/h6,8,10-16,19,28H,4-5,7,9,17-18H2,1-3H3,(H,26,27)/b8-6+ |
| InChIKey | SWFNJLHYCSHKDQ-SOFGYWHQSA-N |
| XLogP | 6.16 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|