C29H43NO10 — CID 176628741
4-O-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 1-O-[[(1R,3S)-2,3,4,5-tetrahydroxycyclohexyl]methyl] butanedioate (PubChem CID 176628741) has the molecular formula C29H43NO10 and a molecular weight of 565.66 g/mol. Its IUPAC name is 4-O-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 1-O-[[(1R,3S)-2,3,4,5-tetrahydroxycyclohexyl]methyl] butanedioate.
| Compound Name | 4-O-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 1-O-[[(1R,3S)-2,3,4,5-tetrahydroxycyclohexyl]methyl] butanedioate |
|---|---|
| PubChem CID | 176628741 |
| Molecular Formula | C29H43NO10 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 4-O-[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 1-O-[[(1R,3S)-2,3,4,5-tetrahydroxycyclohexyl]methyl] butanedioate |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OC(=O)CCC(=O)OC[C@H]1CC(O)C(O)[C@@H](O)C1O |
| InChI | InChI=1S/C29H43NO10/c1-18(2)8-6-4-5-7-9-24(32)30-16-19-10-11-22(23(14-19)38-3)40-26(34)13-12-25(33)39-17-20-15-21(31)28(36)29(37)27(20)35/h6,8,10-11,14,18,20-21,27-29,31,35-37H,4-5,7,9,12-13,15-17H2,1-3H3,(H,30,32)/b8-6+/t20-,21?,27?,28?,29+/m1/s1 |
| InChIKey | PHJWVBUZAFHXBB-VMZWSTQRSA-N |
| XLogP | 1.78 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|