C24H37N3O5 — CID 146310480
[2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 3-(aminomethyl)morpholine-4-carboxylate (PubChem CID 146310480) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 3-(aminomethyl)morpholine-4-carboxylate.
| Compound Name | [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 3-(aminomethyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 146310480 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 3-(aminomethyl)morpholine-4-carboxylate |
| SMILES | COc1cc(CNC(=O)CCCCC=CC(C)C)ccc1OC(=O)N1CCOCC1CN |
| InChI | InChI=1S/C24H37N3O5/c1-18(2)8-6-4-5-7-9-23(28)26-16-19-10-11-21(22(14-19)30-3)32-24(29)27-12-13-31-17-20(27)15-25/h6,8,10-11,14,18,20H,4-5,7,9,12-13,15-17,25H2,1-3H3,(H,26,28) |
| InChIKey | PEZJGKKJRNASBK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|