C42H55NO6 — CID 135012358
[2-methoxy-4-[[[(Z,12R)-12-(2-phenylacetyl)oxyoctadec-9-enoyl]amino]methyl]phenyl] 2-phenylacetate (PubChem CID 135012358) has the molecular formula C42H55NO6 and a molecular weight of 669.90 g/mol. Its IUPAC name is [2-methoxy-4-[[[(Z,12R)-12-(2-phenylacetyl)oxyoctadec-9-enoyl]amino]methyl]phenyl] 2-phenylacetate.
| Compound Name | [2-methoxy-4-[[[(Z,12R)-12-(2-phenylacetyl)oxyoctadec-9-enoyl]amino]methyl]phenyl] 2-phenylacetate |
|---|---|
| PubChem CID | 135012358 |
| Molecular Formula | C42H55NO6 |
| Molecular Weight | 669.90 g/mol |
| Exact Mass | 669.40 |
| IUPAC Name | [2-methoxy-4-[[[(Z,12R)-12-(2-phenylacetyl)oxyoctadec-9-enoyl]amino]methyl]phenyl] 2-phenylacetate |
| SMILES | CCCCCC[C@H](C/C=C\CCCCCCCC(=O)NCc1ccc(OC(=O)Cc2ccccc2)c(OC)c1)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C42H55NO6/c1-3-4-5-18-25-37(48-41(45)31-34-21-14-12-15-22-34)26-19-10-8-6-7-9-11-20-27-40(44)43-33-36-28-29-38(39(30-36)47-2)49-42(46)32-35-23-16-13-17-24-35/h10,12-17,19,21-24,28-30,37H,3-9,11,18,20,25-27,31-33H2,1-2H3,(H,43,44)/b19-10-/t37-/m1/s1 |
| InChIKey | RDKZTLAXXKPYHO-ZGUMAHMYSA-N |
| XLogP | 9.26 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.90 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|