C28H48O2 — CID 142469277
ethane;[(Z)-octadec-9-en-7-yl] 2-phenylacetate (PubChem CID 142469277) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is ethane;[(Z)-octadec-9-en-7-yl] 2-phenylacetate.
| Compound Name | ethane;[(Z)-octadec-9-en-7-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 142469277 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | ethane;[(Z)-octadec-9-en-7-yl] 2-phenylacetate |
| SMILES | CC.CCCCCCCC/C=C\CC(CCCCCC)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H42O2.C2H6/c1-3-5-7-9-10-11-12-13-18-22-25(21-17-8-6-4-2)28-26(27)23-24-19-15-14-16-20-24;1-2/h13-16,18-20,25H,3-12,17,21-23H2,1-2H3;1-2H3/b18-13-; |
| InChIKey | TZVKSBRADKMOJP-AAKIMCHBSA-N |
| XLogP | 8.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|