C32H50N2O3 — CID 91395007
[(7R)-18-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-18-oxooctadec-9-en-7-yl] 2-phenylacetate (PubChem CID 91395007) has the molecular formula C32H50N2O3 and a molecular weight of 510.76 g/mol. Its IUPAC name is [(7R)-18-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-18-oxooctadec-9-en-7-yl] 2-phenylacetate.
| Compound Name | [(7R)-18-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-18-oxooctadec-9-en-7-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 91395007 |
| Molecular Formula | C32H50N2O3 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.38 |
| IUPAC Name | [(7R)-18-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-18-oxooctadec-9-en-7-yl] 2-phenylacetate |
| SMILES | CCCCCC[C@H](CC=CCCCCCCCC(=O)N1C[C@@H]2C[C@H]1CN2C)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C32H50N2O3/c1-3-4-5-15-20-30(37-32(36)23-27-18-13-12-14-19-27)21-16-10-8-6-7-9-11-17-22-31(35)34-26-28-24-29(34)25-33(28)2/h10,12-14,16,18-19,28-30H,3-9,11,15,17,20-26H2,1-2H3/t28-,29-,30+/m0/s1 |
| InChIKey | IUDDOKMHWOAGAK-OIFRRMEBSA-N |
| XLogP | 6.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|