C25H40O4 — CID 170156922
(Z)-12-(2-methoxyphenoxy)octadec-9-enoic acid (PubChem CID 170156922) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is (Z)-12-(2-methoxyphenoxy)octadec-9-enoic acid.
| Compound Name | (Z)-12-(2-methoxyphenoxy)octadec-9-enoic acid |
|---|---|
| PubChem CID | 170156922 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (Z)-12-(2-methoxyphenoxy)octadec-9-enoic acid |
| SMILES | CCCCCCC(C/C=C\CCCCCCCC(=O)O)Oc1ccccc1OC |
| InChI | InChI=1S/C25H40O4/c1-3-4-5-12-17-22(29-24-20-16-15-19-23(24)28-2)18-13-10-8-6-7-9-11-14-21-25(26)27/h10,13,15-16,19-20,22H,3-9,11-12,14,17-18,21H2,1-2H3,(H,26,27)/b13-10- |
| InChIKey | VKCRCCKCRSEXNB-RAXLEYEMSA-N |
| XLogP | 7.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|