C18H34K2O6S+2 — CID 20838605
dipotassium;(E)-12-sulfooxyoctadec-9-enoic acid (PubChem CID 20838605) has the molecular formula C18H34K2O6S+2 and a molecular weight of 456.73 g/mol. Its IUPAC name is dipotassium;(E)-12-sulfooxyoctadec-9-enoic acid.
| Compound Name | dipotassium;(E)-12-sulfooxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 20838605 |
| Molecular Formula | C18H34K2O6S+2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | dipotassium;(E)-12-sulfooxyoctadec-9-enoic acid |
| SMILES | CCCCCCC(C/C=C/CCCCCCCC(=O)O)OS(=O)(=O)O.[K+].[K+] |
| InChI | InChI=1S/C18H34O6S.2K/c1-2-3-4-11-14-17(24-25(21,22)23)15-12-9-7-5-6-8-10-13-16-18(19)20;;/h9,12,17H,2-8,10-11,13-16H2,1H3,(H,19,20)(H,21,22,23);;/q;2*+1/b12-9+;; |
| InChIKey | MLXJANQMZFAJBH-ANOGCNOSSA-N |
| XLogP | -1.09 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|