C18H34O6S — CID 6540476
(E,12R)-12-sulfooxyoctadec-9-enoic acid (PubChem CID 6540476) has the molecular formula C18H34O6S and a molecular weight of 378.53 g/mol. Its IUPAC name is (E,12R)-12-sulfooxyoctadec-9-enoic acid.
| Compound Name | (E,12R)-12-sulfooxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 6540476 |
| Molecular Formula | C18H34O6S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (E,12R)-12-sulfooxyoctadec-9-enoic acid |
| SMILES | CCCCCC[C@H](C/C=C/CCCCCCCC(=O)O)OS(=O)(=O)O |
| InChI | InChI=1S/C18H34O6S/c1-2-3-4-11-14-17(24-25(21,22)23)15-12-9-7-5-6-8-10-13-16-18(19)20/h9,12,17H,2-8,10-11,13-16H2,1H3,(H,19,20)(H,21,22,23)/b12-9+/t17-/m1/s1 |
| InChIKey | CYKFQSXTIVGYDT-XLNAKTSKSA-N |
| XLogP | 4.91 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|