C30H42O4 — CID 70507148
13,14-bis(2-methoxyphenyl)hexadec-10-enoic acid (PubChem CID 70507148) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is 13,14-bis(2-methoxyphenyl)hexadec-10-enoic acid.
| Compound Name | 13,14-bis(2-methoxyphenyl)hexadec-10-enoic acid |
|---|---|
| PubChem CID | 70507148 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 13,14-bis(2-methoxyphenyl)hexadec-10-enoic acid |
| SMILES | CCC(c1ccccc1OC)C(CC=CCCCCCCCCC(=O)O)c1ccccc1OC |
| InChI | InChI=1S/C30H42O4/c1-4-24(26-19-14-16-21-28(26)33-2)25(27-20-15-17-22-29(27)34-3)18-12-10-8-6-5-7-9-11-13-23-30(31)32/h10,12,14-17,19-22,24-25H,4-9,11,13,18,23H2,1-3H3,(H,31,32) |
| InChIKey | RCOMLSOGGMHFFQ-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|