C21H30O3 — CID 67708708
(Z)-6-[2-[(Z)-1-hydroxynon-3-enyl]phenyl]hex-5-enoic acid (PubChem CID 67708708) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (Z)-6-[2-[(Z)-1-hydroxynon-3-enyl]phenyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[2-[(Z)-1-hydroxynon-3-enyl]phenyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 67708708 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (Z)-6-[2-[(Z)-1-hydroxynon-3-enyl]phenyl]hex-5-enoic acid |
| SMILES | CCCCC/C=C\CC(O)c1ccccc1/C=C\CCCC(=O)O |
| InChI | InChI=1S/C21H30O3/c1-2-3-4-5-6-9-16-20(22)19-15-12-11-14-18(19)13-8-7-10-17-21(23)24/h6,8-9,11-15,20,22H,2-5,7,10,16-17H2,1H3,(H,23,24)/b9-6-,13-8- |
| InChIKey | HXMPTUPUMIUNOD-BCLFSJFSSA-N |
| XLogP | 5.51 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|