C22H28O3 — CID 12971727
3-[8-[(E)-1-hydroxynon-3-enyl]naphthalen-2-yl]propanoic acid (PubChem CID 12971727) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 3-[8-[(E)-1-hydroxynon-3-enyl]naphthalen-2-yl]propanoic acid.
| Compound Name | 3-[8-[(E)-1-hydroxynon-3-enyl]naphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 12971727 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-[8-[(E)-1-hydroxynon-3-enyl]naphthalen-2-yl]propanoic acid |
| SMILES | CCCCC/C=C/CC(O)c1cccc2ccc(CCC(=O)O)cc12 |
| InChI | InChI=1S/C22H28O3/c1-2-3-4-5-6-7-11-21(23)19-10-8-9-18-14-12-17(16-20(18)19)13-15-22(24)25/h6-10,12,14,16,21,23H,2-5,11,13,15H2,1H3,(H,24,25)/b7-6+ |
| InChIKey | IIPNQFXPFZPHOG-VOTSOKGWSA-N |
| XLogP | 5.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|