C22H38O4 — CID 171042985
(7Z,10Z,16Z)-13,14-dihydroxydocosa-7,10,16-trienoic acid (PubChem CID 171042985) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is (7Z,10Z,16Z)-13,14-dihydroxydocosa-7,10,16-trienoic acid.
| Compound Name | (7Z,10Z,16Z)-13,14-dihydroxydocosa-7,10,16-trienoic acid |
|---|---|
| PubChem CID | 171042985 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | (7Z,10Z,16Z)-13,14-dihydroxydocosa-7,10,16-trienoic acid |
| SMILES | CCCCC/C=C\CC(O)C(O)C/C=C\C/C=C\CCCCCC(=O)O |
| InChI | InChI=1S/C22H38O4/c1-2-3-4-5-11-14-17-20(23)21(24)18-15-12-9-7-6-8-10-13-16-19-22(25)26/h6-7,11-12,14-15,20-21,23-24H,2-5,8-10,13,16-19H2,1H3,(H,25,26)/b7-6-,14-11-,15-12- |
| InChIKey | INSGBWYBEGXSDL-AIVBDBLXSA-N |
| XLogP | 5.16 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|