About (Z)-octadec-9-enoic acid;phenylmethanamine
(Z)-octadec-9-enoic acid;phenylmethanamine (PubChem CID 56592825) has the molecular formula C25H43NO2
and a molecular weight of 389.62 g/mol. Its IUPAC name is (Z)-octadec-9-enoic acid;phenylmethanamine.
Molecular Properties
| Compound Name | (Z)-octadec-9-enoic acid;phenylmethanamine |
| PubChem CID | 56592825 |
| Molecular Formula | C25H43NO2 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.33 |
| IUPAC Name | (Z)-octadec-9-enoic acid;phenylmethanamine |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.NCc1ccccc1 |
| InChI | InChI=1S/C18H34O2.C7H9N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;8-6-7-4-2-1-3-5-7/h9-10H,2-8,11-17H2,1H3,(H,19,20);1-5H,6,8H2/b10-9-; |
| InChIKey | KEMHWOUMTDBATA-KVVVOXFISA-N |
| XLogP | 7.25 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-9-enoic acid;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-9-enoic acid;phenylmethanamine?
The IUPAC name of (Z)-octadec-9-enoic acid;phenylmethanamine (CID 56592825) is (Z)-octadec-9-enoic acid;phenylmethanamine.
What is the SMILES notation for (Z)-octadec-9-enoic acid;phenylmethanamine?
The canonical SMILES for (Z)-octadec-9-enoic acid;phenylmethanamine is CCCCCCCC/C=C\CCCCCCCC(=O)O.NCc1ccccc1.
What is the InChIKey of (Z)-octadec-9-enoic acid;phenylmethanamine?
The InChIKey is KEMHWOUMTDBATA-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C7H9N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;8-6-7-4-2-1-3-5-7/h9-10H,2-8,11-17H2,1H3,(H,19,20);1-5H,6,8H2/b10-9-;.
What are the key properties of (Z)-octadec-9-enoic acid;phenylmethanamine?
(Z)-octadec-9-enoic acid;phenylmethanamine has a molecular weight of 389.62 g/mol, XLogP of 7.25, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-enoic acid;phenylmethanamine is sourced from PubChem (CID 56592825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).