C28H40O3 — CID 24881381
naphthalen-1-yl (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 24881381) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is naphthalen-1-yl (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | naphthalen-1-yl (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 24881381 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | naphthalen-1-yl (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C28H40O3/c1-2-3-4-11-19-25(29)20-12-9-7-5-6-8-10-13-23-28(30)31-27-22-16-18-24-17-14-15-21-26(24)27/h9,12,14-18,21-22,25,29H,2-8,10-11,13,19-20,23H2,1H3/b12-9-/t25-/m1/s1 |
| InChIKey | XKTGOQUEGKDIIZ-CNPINADKSA-N |
| XLogP | 7.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|