C36H68O3 — CID 124524443
[(E)-octadec-9-enyl] (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 124524443) has the molecular formula C36H68O3 and a molecular weight of 548.94 g/mol. Its IUPAC name is [(E)-octadec-9-enyl] (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | [(E)-octadec-9-enyl] (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 124524443 |
| Molecular Formula | C36H68O3 |
| Molecular Weight | 548.94 g/mol |
| Exact Mass | 548.52 |
| IUPAC Name | [(E)-octadec-9-enyl] (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCCOC(=O)CCCCCCC/C=C\C[C@H](O)CCCCCC |
| InChI | InChI=1S/C36H68O3/c1-3-5-7-9-10-11-12-13-14-15-16-17-20-23-26-30-34-39-36(38)33-29-25-22-19-18-21-24-28-32-35(37)31-27-8-6-4-2/h13-14,24,28,35,37H,3-12,15-23,25-27,29-34H2,1-2H3/b14-13+,28-24-/t35-/m1/s1 |
| InChIKey | VUEAHKMMTNDIEH-WDFFUWIMSA-N |
| XLogP | 11.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.94 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|