C22H44O7S — CID 87781687
butyl (Z,12R)-12-hydroxyoctadec-9-enoate;sulfuric acid (PubChem CID 87781687) has the molecular formula C22H44O7S and a molecular weight of 452.65 g/mol. Its IUPAC name is butyl (Z,12R)-12-hydroxyoctadec-9-enoate;sulfuric acid.
| Compound Name | butyl (Z,12R)-12-hydroxyoctadec-9-enoate;sulfuric acid |
|---|---|
| PubChem CID | 87781687 |
| Molecular Formula | C22H44O7S |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | butyl (Z,12R)-12-hydroxyoctadec-9-enoate;sulfuric acid |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OCCCC.O=S(=O)(O)O |
| InChI | InChI=1S/C22H42O3.H2O4S/c1-3-5-7-14-17-21(23)18-15-12-10-8-9-11-13-16-19-22(24)25-20-6-4-2;1-5(2,3)4/h12,15,21,23H,3-11,13-14,16-20H2,1-2H3;(H2,1,2,3,4)/b15-12-;/t21-;/m1./s1 |
| InChIKey | JMFWGLMWDWJHPX-OSMKWQFQSA-N |
| XLogP | 5.69 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|