About 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate
5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate (PubChem CID 54483460) has the molecular formula C25H48O3
and a molecular weight of 396.66 g/mol. Its IUPAC name is 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate.
Molecular Properties
| Compound Name | 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate |
| PubChem CID | 54483460 |
| Molecular Formula | C25H48O3 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.36 |
| IUPAC Name | 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OCCCCC(C)C |
| InChI | InChI=1S/C25H48O3/c1-4-5-6-13-19-24(26)20-14-11-9-7-8-10-12-15-21-25(27)28-22-17-16-18-23(2)3/h11,14,23-24,26H,4-10,12-13,15-22H2,1-3H3/t24-/m1/s1 |
| InChIKey | XQQQMMMNIMHGQG-XMMPIXPASA-N |
| XLogP | 7.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate?
The IUPAC name of 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate (CID 54483460) is 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate.
What is the SMILES notation for 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate?
The canonical SMILES for 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate is CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OCCCCC(C)C.
What is the InChIKey of 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate?
The InChIKey is XQQQMMMNIMHGQG-XMMPIXPASA-N. The full InChI is InChI=1S/C25H48O3/c1-4-5-6-13-19-24(26)20-14-11-9-7-8-10-12-15-21-25(27)28-22-17-16-18-23(2)3/h11,14,23-24,26H,4-10,12-13,15-22H2,1-3H3/t24-/m1/s1.
What are the key properties of 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate?
5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate has a molecular weight of 396.66 g/mol, XLogP of 7.36, 20 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexyl (12R)-12-hydroxyoctadec-9-enoate is sourced from PubChem (CID 54483460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).