C32H58O5 — CID 91323012
16-(12-hydroxyhexadec-9-enoyloxy)hexadec-9-enoic acid (PubChem CID 91323012) has the molecular formula C32H58O5 and a molecular weight of 522.81 g/mol. Its IUPAC name is 16-(12-hydroxyhexadec-9-enoyloxy)hexadec-9-enoic acid.
| Compound Name | 16-(12-hydroxyhexadec-9-enoyloxy)hexadec-9-enoic acid |
|---|---|
| PubChem CID | 91323012 |
| Molecular Formula | C32H58O5 |
| Molecular Weight | 522.81 g/mol |
| Exact Mass | 522.43 |
| IUPAC Name | 16-(12-hydroxyhexadec-9-enoyloxy)hexadec-9-enoic acid |
| SMILES | CCCCC(O)CC=CCCCCCCCC(=O)OCCCCCCC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C32H58O5/c1-2-3-25-30(33)26-21-17-13-10-11-15-19-23-28-32(36)37-29-24-20-16-12-8-6-4-5-7-9-14-18-22-27-31(34)35/h4,6,17,21,30,33H,2-3,5,7-16,18-20,22-29H2,1H3,(H,34,35) |
| InChIKey | MBLBIRMWRCRHFF-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.81 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|