C39H50O4 — CID 161344266
acetyl (Z,12R)-12-hydroxyoctadec-9-enoate;1-methylchrysene (PubChem CID 161344266) has the molecular formula C39H50O4 and a molecular weight of 582.83 g/mol. Its IUPAC name is acetyl (Z,12R)-12-hydroxyoctadec-9-enoate;1-methylchrysene.
| Compound Name | acetyl (Z,12R)-12-hydroxyoctadec-9-enoate;1-methylchrysene |
|---|---|
| PubChem CID | 161344266 |
| Molecular Formula | C39H50O4 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | acetyl (Z,12R)-12-hydroxyoctadec-9-enoate;1-methylchrysene |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OC(C)=O.Cc1cccc2c1ccc1c3ccccc3ccc21 |
| InChI | InChI=1S/C20H36O4.C19H14/c1-3-4-5-12-15-19(22)16-13-10-8-6-7-9-11-14-17-20(23)24-18(2)21;1-13-5-4-8-17-15(13)11-12-18-16-7-3-2-6-14(16)9-10-19(17)18/h10,13,19,22H,3-9,11-12,14-17H2,1-2H3;2-12H,1H3/b13-10-;/t19-;/m1./s1 |
| InChIKey | VNBYMLROOBXCIN-DWUIFXBBSA-N |
| XLogP | 10.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|