C25H46O6 — CID 87989877
acetyl (Z,12R)-12-hydroxyoctadec-9-enoate;2-prop-2-enoxyethanol (PubChem CID 87989877) has the molecular formula C25H46O6 and a molecular weight of 442.64 g/mol. Its IUPAC name is acetyl (Z,12R)-12-hydroxyoctadec-9-enoate;2-prop-2-enoxyethanol.
| Compound Name | acetyl (Z,12R)-12-hydroxyoctadec-9-enoate;2-prop-2-enoxyethanol |
|---|---|
| PubChem CID | 87989877 |
| Molecular Formula | C25H46O6 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | acetyl (Z,12R)-12-hydroxyoctadec-9-enoate;2-prop-2-enoxyethanol |
| SMILES | C=CCOCCO.CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OC(C)=O |
| InChI | InChI=1S/C20H36O4.C5H10O2/c1-3-4-5-12-15-19(22)16-13-10-8-6-7-9-11-14-17-20(23)24-18(2)21;1-2-4-7-5-3-6/h10,13,19,22H,3-9,11-12,14-17H2,1-2H3;2,6H,1,3-5H2/b13-10-;/t19-;/m1./s1 |
| InChIKey | YSQSRBVIKCSXGC-DWUIFXBBSA-N |
| XLogP | 5.27 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|