C36H62O4 — CID 168953151
[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl] (Z)-12-hydroxyoctadec-9-enoate (PubChem CID 168953151) has the molecular formula C36H62O4 and a molecular weight of 558.89 g/mol. Its IUPAC name is [(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl] (Z)-12-hydroxyoctadec-9-enoate.
| Compound Name | [(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl] (Z)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 168953151 |
| Molecular Formula | C36H62O4 |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.46 |
| IUPAC Name | [(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl] (Z)-12-hydroxyoctadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(=O)CCCCCCC/C=C\CC(O)CCCCCC |
| InChI | InChI=1S/C36H62O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-21-24-28-32-35(38)40-36(39)33-29-25-22-19-18-20-23-27-31-34(37)30-26-8-6-4-2/h5,7,10-11,13-14,23,27,34,37H,3-4,6,8-9,12,15-22,24-26,28-33H2,1-2H3/b7-5-,11-10-,14-13-,27-23- |
| InChIKey | XFJAJRKYVNNQJU-SVXZZJEASA-N |
| XLogP | 10.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|