C26H46O3 — CID 46831420
2-hydroxyoctyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 46831420) has the molecular formula C26H46O3 and a molecular weight of 406.65 g/mol. Its IUPAC name is 2-hydroxyoctyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | 2-hydroxyoctyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 46831420 |
| Molecular Formula | C26H46O3 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.34 |
| IUPAC Name | 2-hydroxyoctyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCC(O)CCCCCC |
| InChI | InChI=1S/C26H46O3/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-21-23-26(28)29-24-25(27)22-20-8-6-4-2/h5,7,10-11,13-14,25,27H,3-4,6,8-9,12,15-24H2,1-2H3/b7-5-,11-10-,14-13- |
| InChIKey | CGNXUYGEXJMXDY-LNCSVHMCSA-N |
| XLogP | 7.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|