C35H58O5 — CID 131801861
[(2S)-2-hydroxy-3-[(Z)-tetradec-5-enoyl]oxypropyl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate (PubChem CID 131801861) has the molecular formula C35H58O5 and a molecular weight of 558.84 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[(Z)-tetradec-5-enoyl]oxypropyl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate.
| Compound Name | [(2S)-2-hydroxy-3-[(Z)-tetradec-5-enoyl]oxypropyl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
|---|---|
| PubChem CID | 131801861 |
| Molecular Formula | C35H58O5 |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.43 |
| IUPAC Name | [(2S)-2-hydroxy-3-[(Z)-tetradec-5-enoyl]oxypropyl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC[C@H](O)COC(=O)CCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C35H58O5/c1-3-5-7-9-11-13-15-16-17-18-20-22-24-26-28-30-35(38)40-32-33(36)31-39-34(37)29-27-25-23-21-19-14-12-10-8-6-4-2/h5,7,11,13,16-17,20-23,33,36H,3-4,6,8-10,12,14-15,18-19,24-32H2,1-2H3/b7-5-,13-11-,17-16-,22-20-,23-21-/t33-/m1/s1 |
| InChIKey | JXOBLOUJGKKGGQ-BSXPULOESA-N |
| XLogP | 9.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|