C23H42O3 — CID 46831120
2-hydroxypentyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 46831120) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is 2-hydroxypentyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2-hydroxypentyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 46831120 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 2-hydroxypentyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)CCC |
| InChI | InChI=1S/C23H42O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(25)26-21-22(24)19-4-2/h8-9,11-12,22,24H,3-7,10,13-21H2,1-2H3/b9-8-,12-11- |
| InChIKey | NKFMDKGUVAMJFH-MURFETPASA-N |
| XLogP | 6.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|