C31H52O6 — CID 157005197
[(2S)-2-hydroxy-3-octanoyloxypropyl] (5Z,8Z,11Z,14Z)-17-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 157005197) has the molecular formula C31H52O6 and a molecular weight of 520.75 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-octanoyloxypropyl] (5Z,8Z,11Z,14Z)-17-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [(2S)-2-hydroxy-3-octanoyloxypropyl] (5Z,8Z,11Z,14Z)-17-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 157005197 |
| Molecular Formula | C31H52O6 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | [(2S)-2-hydroxy-3-octanoyloxypropyl] (5Z,8Z,11Z,14Z)-17-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCCCC(=O)OC[C@H](O)COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CC(O)CCC |
| InChI | InChI=1S/C31H52O6/c1-3-5-6-16-20-24-30(34)36-26-29(33)27-37-31(35)25-21-18-15-13-11-9-7-8-10-12-14-17-19-23-28(32)22-4-2/h7,9-10,12-13,15,17,19,28-29,32-33H,3-6,8,11,14,16,18,20-27H2,1-2H3/b9-7-,12-10-,15-13-,19-17-/t28?,29-/m0/s1 |
| InChIKey | JIXCYDHYNHWZKJ-CBJUBDCASA-N |
| XLogP | 6.91 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|